| Name | 1,4-Dimethylpyrazole |
| Synonyms | 1,4-DIMETHYLPYRAZOLE 1,4-Dimethylpyrazole Pyrazole, 1,4-dimethyl- 1,4-two methyl pyrazole 1,4-Dimethyl-1H-pyrazol 1,4-Dimethyl-1H-pyrazole 1,4-DIMETHYL-1H-PYRAZOLE 1H-Pyrazole, -1,4-dimethyl- |
| CAS | 1072-68-0 |
| EINECS | 600-813-6 |
| InChI | InChI=1/C5H8N2/c1-5-3-6-7(2)4-5/h3-4H,1-2H3 |
| Molecular Formula | C5H8N2 |
| Molar Mass | 96.13 |
| Density | 0.9608 g/cm3(Temp: 18 °C) |
| Boling Point | 148-150 °C(Press: 20 Torr) |
| Flash Point | 41.9°C |
| Vapor Presure | 3.47-21.3hPa at 20-50℃ |
| pKa | 2.80±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.518 |
| Physical and Chemical Properties | Boiling Point: 151 ℃ |
| surface tension | 68.8mN/m at 1g/L and 20 ℃ |
| Use | an important intermediate of the herbicide chlorpyrisulfuron-methyl, a drug intermediate. |